KUIZ 5 - LIPIDS
1. Describe what are fatty acids? What are the different between fatty acids and
triacylglycerol?
2. What does amphiphilic means?
3. Work out the shorthand nomenclature for each of the following fatty acids.
a) CH3(CH2)5CH=CH(CH2)7COOH
b) CH3(CH2)5CH=CHCH2CH=CH(CH2)4COOH
c) CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOH
4. Draw the chemical structures for the following abbreviated symbol of each fatty acid
below. Give the common name for the structure.
a) 12:0
b) 16:19
c) 18:29,12
5. What are the different between fats and oils?
6. There are two types of triacylglycerol hydrolysis process. Describe both processes.
7. The preparation of oleomargarine, a butter which is more spreadable then ordinary
butter is involved the partial hydrogenation process.
a) Describe what is partial hydrogenation?
b) What is the major drawback of the partial hydrogenation process?
c) What is autooxidation?
d) Explain how the hydrogenation process can reduced the autooxidation in
lipids?
8. What are the main differences between nonpolar and polar lipids?
9. There are two types of polar lipids.
a) Name both types of polar lipids.
b) Give three examples from each type of the polar lipids.
Download

KUIZ 5 - LIPIDS Describe what are fatty acids? What are the different