Oxford High School
Honors Chemistry
Mr. Urig
Chapter 26 HW Packet
I.
Name or draw the structural formulas for the following
1. Name the halocarbon with the following condensed structural formula:
CH2ClCHClCH2CH3
2. Name the halocarbon with the following condensed structural formula:
CH2FCHBr(CH2)4CH3
3. Name the halocarbon with the following condensed structural formula:
CH2FCH2CHF(CH2)3CH3
4. Provide the condensed structural formula for 2-chlorobutane.
5. Provide the condensed structural formula for 3-bromohexane
6. Provide the condensed structural formula for 2,3-difluoropentane
7. What is the name and type of the alcohol described by the condensed structural formula
CH3CHOH(CH2)6CH3
8. What is the name and type of the alcohol described by the condensed structural formula
CH2OHCH(CH3)CH3
9. What is the name and type of the alcohol described by the condensed structural formula
CH2OHCH2CH3
10. Provide the condensed structural formula for 4-ethyl-3-heptanol. What type of alcohol is it?
11. Provide the condensed structural formula for 2-methyl-2-butanol. What type of alcohol is it?
12. Provide the condensed structural formula for 2-heptanol. What type of alcohol is it?
13. Give the IUPAC name and common name for the ether with the following condensed structural
formula: CH3OCH3
14. An ether has the IUPAC name ethoxybutane. What is its common name?
15. An ether has the IUPAC name propoxypentane. What is its common name?
16. Give the IUPAC and the common name for the ether with the following condensed structural
formula: CH3CH2O(CH2)5CH3
17. Give the IUPAC and common name for the ether with the following condensed structural
formula: CH3O(CH2)2CH3
18. An ether has the IUPAC name propoxyheptane. What is its common name?
19. An ether has the IUPAC name propoxypropane. What is its common name?
20. Give the IUPAC and the common name for the ether with the following condensed structural
formula: CH3(CH2)2O(CH2)5CH3
21. Name the molecule represented by the following structural formula:
22. Name the molecule represented by the following condensed structural formula: CH3(CH2)5CHO
23. Name the molecule represented by the following structural formula:
H
O
H
H
H
C
H
C
C
C
H
H
H
24. Name the molecule represented by the following structural formula:
25. Write the condensed structural formula for pentanal.
26. Name the molecule represented by the following condensed structural formula:
CH3CH2CO(CH2)5CH3
27. Write the condensed structural formula for hexanal.
28. Name the molecule represented by the following condensed structural formula: CH3(CH2)6CHO
29. Write the condensed structural formula for 3-heptanone.
30. Name the molecule represented by the following condensed structural formula:CH3(CH2)7CHO
31. Name the carboxylic acid with the following condensed structural formula: CH3(CH2)5COOH
32. Name the carboxylic acid with the following condensed structural formula:
CH3CH2CH(CH3)(CH2)2COOH
33. Name the carboxylic acid with the following condensed structural formula:
CH3(CH2)2CH(CH3)(CH2)3COOH
34. Write the condensed structural formula for propanoic acid.
35. Write the condensed structural formula for octanoic acid.
36. Name the carboxylic acid with the following condensed structural formula: CH3CH(CH3)COOH
37. Name the carboxylic acid with the following condensed structural formula: CH3(CH2)3COOH
38. Write the condensed structural formula for nonanoic acid.
39. Give the IUPAC name for lactic acid, which has a condensed structural formula CH3CH(OH)COOH
(Hint: use the prefix hydroxyl for the extra OH)
40. Write the condensed structural formula for decanoic acid
41. What is the name of the ester derived from the reaction between ethanol and butanoic acid?
42. What is the name of the ester derived from the reaction between propanol and pentanoic acid?
43. What is the name of the ester derived from the reaction between methanol and ethanoic acid?
44. What is the name of the ester derived from the reaction between ethanol and octanoic acid?
45. Write the condensed structural formula for butyl propanoate
46. What is the name of the ester derived from the reaction between methanol and methanoic
acid?
47. Write a condensed structural formula for propyl butanoate.
48. What is the name of the ester derived from the reaction between ethanol and propanoic acid?
49. What is the name of the ester derived from the reaction between methanol and heptanoic acid?
50. What is the name of the ester derived from the reaction between butanol and pentanoic acid?
51. Name the compound CH3(CH2)7NH2
52. Name the compound CH3CH2CH(NH2)(CH2)3CH3
53. Name the compound CH3(CH2)CH(NH2)(CH2)4CH3
54. Name the compound CH3CH(NH2)CH2CH3
55. Name the compound CH3(CH2)5NH2
56. Write the condensed structural formula for 2-pentanamine
57. Write the condensed structural formula for 3-octanamine
58. Write the condensed structural formula for methanamine
59. Write the condensed structural formula for nonanamine
60. Write the condensed structural formula for 4-decanamine
61. Write the condensed structural formula for nonanamide
62. Write the condensed structural formula for 2-methylbutanamide
63. Write the condensed structural formula for octanamide
64. Write the condensed structural formula for decanamide
65. Write the condensed structural formula for 3-methylhexanamide.
66. Name the amide CH3CH2CONH2
67. Name the amide CH3(CH2)8CONH2
68. Name the amide CHONH2
69. Name the amide CH3(CH2)5CONH2
70. Name the amide CH3CH(CH3)CH2CH2CONH2
II.
Matching
71. _____ hydrocarbon
72. _____ hydrocarbon derivative
73. _____ functional group
74. _____ halocarbon
75. _____ hydroxyl group
76. _____ alcohol
77. _____ ether
78. _____ diol
III.
79.
80.
81.
82.
83.
84.
85.
86.
87.
88.
89.
90.
91.
92.
93.
94.
95.
96.
97.
98.
99.
a. hydrocarbon in which one or more hydrogen atoms
have been replaced by a halogen.
b. portion of a compound that determines the
properties of the hydrocarbon derivative
c. hydrocarbon that contains an oxygen atom between
two carbon atoms
d. compound that contains additional atoms other than
carbon and hydrogen
e. hydrocarbon in which one or more hydrogens have
been replaced by a hydroxyl group
f. –OH
g. compound that consists of only hydrogen and carbon
h. alcohol that contains two hydroxyl groups
True or False – correct false answers
_____ A primary alcohol has a hydroxyl group on the interior of the hydrocarbon chain.
_____ The common name for ethanol is grain alcohol.
_____ Alcohols have a lower boiling points than the hydrocarbon from which they were derived.
_____ A hydrocarbon in which the functional group consists of bromine is an ether.
_____ Halocarbons are nonpolar.
_____ Ethers have a higher boiling point than alcohols.
_____ Aldehydes and ketones are less polar than hydrocarbons.
_____ Aldehydes and ketones have lower melting points and boiling points than alcohols.
_____Hydrocarbons have stronger intermolecular forces than aldehydes and ketones.
_____ The simplest ketone is acetone.
_____ Ethanol is the IUPAC name for formaldehyde.
_____ The hydrogen atom in a carboxyl group is an acidic hydrogen.
_____ The carboxyl end of a carboxylic acid is electron rich.
_____ Carboxylic acids are less soluble in water than hydrocarbons.
_____ Esters are capable of forming hydrogen bonds.
_____ The simplest carboxylic acid is acetic acid.
_____ The ester is formed between a carboxylic acid and a hydrocarbon.
_____ Esters have lower boiling points than alcohols.
_____ The boiling point of an amine is lower than the boiling point of an alcohol.
_____ Amines act as strong bases.
_____ Amines are less polar than alcohols.
100.
101.
IV.
An amide bond is also called a peptide bond.
An amino group is polar.
Fill in the Blank
carbonyl group
carboxyl group
carboxylic acid
organic acid
fatty acid
ester
formic acid
acetic acid
102.
Another name for a carboxylic acid is __________________.
103.
The functional group for a carboxylic acid is _____________________.
104.
A(n) _________________ contains a hydrocarbon, rather than hydrogen, in its
functional group.
105.
A carboxylic acid that has been extracted from animal fat is called ___________.
106.
A(n) _____________ is identified by the presence of a carboxyl group.
V.
Essays
107.
Explain why benzoic acid is more soluble in water than octane. Use diagrams and
words.
108.
What gives alcohols their strong intermolecular forces? Use diagrams and words.